C24H33N3S — CID 88680326
N-[3-[5-(4-phenylpiperazin-1-yl)pentyl]phenyl]propanethioamide (PubChem CID 88680326) has the molecular formula C24H33N3S and a molecular weight of 395.62 g/mol. Its IUPAC name is N-[3-[5-(4-phenylpiperazin-1-yl)pentyl]phenyl]propanethioamide.
| Compound Name | N-[3-[5-(4-phenylpiperazin-1-yl)pentyl]phenyl]propanethioamide |
|---|---|
| PubChem CID | 88680326 |
| Molecular Formula | C24H33N3S |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | N-[3-[5-(4-phenylpiperazin-1-yl)pentyl]phenyl]propanethioamide |
| SMILES | CCC(=S)Nc1cccc(CCCCCN2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C24H33N3S/c1-2-24(28)25-22-12-9-11-21(20-22)10-5-4-8-15-26-16-18-27(19-17-26)23-13-6-3-7-14-23/h3,6-7,9,11-14,20H,2,4-5,8,10,15-19H2,1H3,(H,25,28) |
| InChIKey | YYMYJCVUNRAQNH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|