C19H27N3O — CID 142390486
5-methyl-3-[5-(4-phenylpiperazin-1-yl)pentyl]-1,2-oxazole (PubChem CID 142390486) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is 5-methyl-3-[5-(4-phenylpiperazin-1-yl)pentyl]-1,2-oxazole.
| Compound Name | 5-methyl-3-[5-(4-phenylpiperazin-1-yl)pentyl]-1,2-oxazole |
|---|---|
| PubChem CID | 142390486 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 5-methyl-3-[5-(4-phenylpiperazin-1-yl)pentyl]-1,2-oxazole |
| SMILES | Cc1cc(CCCCCN2CCN(c3ccccc3)CC2)no1 |
| InChI | InChI=1S/C19H27N3O/c1-17-16-18(20-23-17)8-4-3-7-11-21-12-14-22(15-13-21)19-9-5-2-6-10-19/h2,5-6,9-10,16H,3-4,7-8,11-15H2,1H3 |
| InChIKey | QVCIGKUIZZPSHF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|