C19H29N3O — CID 177319242
ethane;5-methyl-3-[3-(4-phenylpiperazin-1-yl)propyl]-1,2-oxazole (PubChem CID 177319242) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is ethane;5-methyl-3-[3-(4-phenylpiperazin-1-yl)propyl]-1,2-oxazole.
| Compound Name | ethane;5-methyl-3-[3-(4-phenylpiperazin-1-yl)propyl]-1,2-oxazole |
|---|---|
| PubChem CID | 177319242 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | ethane;5-methyl-3-[3-(4-phenylpiperazin-1-yl)propyl]-1,2-oxazole |
| SMILES | CC.Cc1cc(CCCN2CCN(c3ccccc3)CC2)no1 |
| InChI | InChI=1S/C17H23N3O.C2H6/c1-15-14-16(18-21-15)6-5-9-19-10-12-20(13-11-19)17-7-3-2-4-8-17;1-2/h2-4,7-8,14H,5-6,9-13H2,1H3;1-2H3 |
| InChIKey | SZICPPKHYNRWCY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |