C37H50N6O3 — CID 146942040
5-methyl-3-[2-[4-[4-[2-[3-[4-[4-(4-methylphenyl)piperazin-1-yl]butyl]-1,2-oxazol-5-yl]ethyl]phenyl]piperazin-1-yl]ethoxymethyl]-1,2-oxazole (PubChem CID 146942040) has the molecular formula C37H50N6O3 and a molecular weight of 626.85 g/mol. Its IUPAC name is 5-methyl-3-[2-[4-[4-[2-[3-[4-[4-(4-methylphenyl)piperazin-1-yl]butyl]-1,2-oxazol-5-yl]ethyl]phenyl]piperazin-1-yl]ethoxymethyl]-1,2-oxazole.
| Compound Name | 5-methyl-3-[2-[4-[4-[2-[3-[4-[4-(4-methylphenyl)piperazin-1-yl]butyl]-1,2-oxazol-5-yl]ethyl]phenyl]piperazin-1-yl]ethoxymethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 146942040 |
| Molecular Formula | C37H50N6O3 |
| Molecular Weight | 626.85 g/mol |
| Exact Mass | 626.39 |
| IUPAC Name | 5-methyl-3-[2-[4-[4-[2-[3-[4-[4-(4-methylphenyl)piperazin-1-yl]butyl]-1,2-oxazol-5-yl]ethyl]phenyl]piperazin-1-yl]ethoxymethyl]-1,2-oxazole |
| SMILES | Cc1ccc(N2CCN(CCCCc3cc(CCc4ccc(N5CCN(CCOCc6cc(C)on6)CC5)cc4)on3)CC2)cc1 |
| InChI | InChI=1S/C37H50N6O3/c1-30-6-11-35(12-7-30)42-21-17-40(18-22-42)16-4-3-5-33-28-37(46-38-33)15-10-32-8-13-36(14-9-32)43-23-19-41(20-24-43)25-26-44-29-34-27-31(2)45-39-34/h6-9,11-14,27-28H,3-5,10,15-26,29H2,1-2H3 |
| InChIKey | AHBDTGCZBFUHDN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 74.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.85 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|