C20H28N3O2+ — CID 158614564
5-methyl-3-[[7-(4-methylphenyl)-7-aza-4-azoniaspiro[3.5]nonan-2-yl]methoxymethyl]-1,2-oxazole (PubChem CID 158614564) has the molecular formula C20H28N3O2+ and a molecular weight of 342.46 g/mol. Its IUPAC name is 5-methyl-3-[[7-(4-methylphenyl)-7-aza-4-azoniaspiro[3.5]nonan-2-yl]methoxymethyl]-1,2-oxazole.
| Compound Name | 5-methyl-3-[[7-(4-methylphenyl)-7-aza-4-azoniaspiro[3.5]nonan-2-yl]methoxymethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 158614564 |
| Molecular Formula | C20H28N3O2+ |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 5-methyl-3-[[7-(4-methylphenyl)-7-aza-4-azoniaspiro[3.5]nonan-2-yl]methoxymethyl]-1,2-oxazole |
| SMILES | Cc1ccc(N2CC[N+]3(CC2)CC(COCc2cc(C)on2)C3)cc1 |
| InChI | InChI=1S/C20H28N3O2/c1-16-3-5-20(6-4-16)22-7-9-23(10-8-22)12-18(13-23)14-24-15-19-11-17(2)25-21-19/h3-6,11,18H,7-10,12-15H2,1-2H3/q+1 |
| InChIKey | FRFQJWXDVHHTJZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|