C25H37N3O3S — CID 70458180
2-methoxy-5-[5-(4-phenylpiperazin-1-yl)pentyl]-N-propylbenzenesulfonamide (PubChem CID 70458180) has the molecular formula C25H37N3O3S and a molecular weight of 459.66 g/mol. Its IUPAC name is 2-methoxy-5-[5-(4-phenylpiperazin-1-yl)pentyl]-N-propylbenzenesulfonamide.
| Compound Name | 2-methoxy-5-[5-(4-phenylpiperazin-1-yl)pentyl]-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 70458180 |
| Molecular Formula | C25H37N3O3S |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 2-methoxy-5-[5-(4-phenylpiperazin-1-yl)pentyl]-N-propylbenzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1cc(CCCCCN2CCN(c3ccccc3)CC2)ccc1OC |
| InChI | InChI=1S/C25H37N3O3S/c1-3-15-26-32(29,30)25-21-22(13-14-24(25)31-2)10-6-5-9-16-27-17-19-28(20-18-27)23-11-7-4-8-12-23/h4,7-8,11-14,21,26H,3,5-6,9-10,15-20H2,1-2H3 |
| InChIKey | DMQRADYDWCTGFG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|