C28H43N3O2S2 — CID 57237384
2-methylsulfanyl-5-[5-(4-phenylpiperazin-1-yl)pentyl]-N,N-dipropylbenzenesulfonamide (PubChem CID 57237384) has the molecular formula C28H43N3O2S2 and a molecular weight of 517.81 g/mol. Its IUPAC name is 2-methylsulfanyl-5-[5-(4-phenylpiperazin-1-yl)pentyl]-N,N-dipropylbenzenesulfonamide.
| Compound Name | 2-methylsulfanyl-5-[5-(4-phenylpiperazin-1-yl)pentyl]-N,N-dipropylbenzenesulfonamide |
|---|---|
| PubChem CID | 57237384 |
| Molecular Formula | C28H43N3O2S2 |
| Molecular Weight | 517.81 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | 2-methylsulfanyl-5-[5-(4-phenylpiperazin-1-yl)pentyl]-N,N-dipropylbenzenesulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1cc(CCCCCN2CCN(c3ccccc3)CC2)ccc1SC |
| InChI | InChI=1S/C28H43N3O2S2/c1-4-17-31(18-5-2)35(32,33)28-24-25(15-16-27(28)34-3)12-8-7-11-19-29-20-22-30(23-21-29)26-13-9-6-10-14-26/h6,9-10,13-16,24H,4-5,7-8,11-12,17-23H2,1-3H3 |
| InChIKey | BVDSMSORJGXYDC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.81 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|