C21H24N4O2 — CID 11089822
6-[3-(4-phenylpiperazin-1-yl)propyl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 11089822) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 6-[3-(4-phenylpiperazin-1-yl)propyl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[3-(4-phenylpiperazin-1-yl)propyl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 11089822 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 6-[3-(4-phenylpiperazin-1-yl)propyl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccc(CCCN3CCN(c4ccccc4)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C21H24N4O2/c26-20-21(27)23-19-15-16(8-9-18(19)22-20)5-4-10-24-11-13-25(14-12-24)17-6-2-1-3-7-17/h1-3,6-9,15H,4-5,10-14H2,(H,22,26)(H,23,27) |
| InChIKey | FLLCBZBFPOOYMV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|