C22H31N3O4S2 — CID 57291702
2-methylsulfonyl-5-[5-(4-phenylpiperazin-1-yl)pentyl]benzenesulfonamide (PubChem CID 57291702) has the molecular formula C22H31N3O4S2 and a molecular weight of 465.64 g/mol. Its IUPAC name is 2-methylsulfonyl-5-[5-(4-phenylpiperazin-1-yl)pentyl]benzenesulfonamide.
| Compound Name | 2-methylsulfonyl-5-[5-(4-phenylpiperazin-1-yl)pentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 57291702 |
| Molecular Formula | C22H31N3O4S2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 2-methylsulfonyl-5-[5-(4-phenylpiperazin-1-yl)pentyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(CCCCCN2CCN(c3ccccc3)CC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C22H31N3O4S2/c1-30(26,27)21-12-11-19(18-22(21)31(23,28)29)8-4-3-7-13-24-14-16-25(17-15-24)20-9-5-2-6-10-20/h2,5-6,9-12,18H,3-4,7-8,13-17H2,1H3,(H2,23,28,29) |
| InChIKey | DFYCVKBGOHHBCY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|