C18H30Cl2N2O2 — CID 142749388
2-[2-(4-phenylpiperazin-1-yl)ethyl]hexanoic acid;dihydrochloride (PubChem CID 142749388) has the molecular formula C18H30Cl2N2O2 and a molecular weight of 377.36 g/mol. Its IUPAC name is 2-[2-(4-phenylpiperazin-1-yl)ethyl]hexanoic acid;dihydrochloride.
| Compound Name | 2-[2-(4-phenylpiperazin-1-yl)ethyl]hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 142749388 |
| Molecular Formula | C18H30Cl2N2O2 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-[2-(4-phenylpiperazin-1-yl)ethyl]hexanoic acid;dihydrochloride |
| SMILES | CCCCC(CCN1CCN(c2ccccc2)CC1)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C18H28N2O2.2ClH/c1-2-3-7-16(18(21)22)10-11-19-12-14-20(15-13-19)17-8-5-4-6-9-17;;/h4-6,8-9,16H,2-3,7,10-15H2,1H3,(H,21,22);2*1H |
| InChIKey | AVMGVZSFDJFHJR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |