C19H32N4O — CID 119901943
(2S)-2-amino-3,3-dimethyl-N-[3-(4-phenylpiperazin-1-yl)propyl]butanamide (PubChem CID 119901943) has the molecular formula C19H32N4O and a molecular weight of 332.49 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-[3-(4-phenylpiperazin-1-yl)propyl]butanamide.
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-[3-(4-phenylpiperazin-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 119901943 |
| Molecular Formula | C19H32N4O |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-[3-(4-phenylpiperazin-1-yl)propyl]butanamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)NCCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H32N4O/c1-19(2,3)17(20)18(24)21-10-7-11-22-12-14-23(15-13-22)16-8-5-4-6-9-16/h4-6,8-9,17H,7,10-15,20H2,1-3H3,(H,21,24)/t17-/m1/s1 |
| InChIKey | DMVDJEYDHWUOBT-QGZVFWFLSA-N |
| XLogP | 1.69 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|