C14H21N3S2 — CID 88699307
3-(4-phenylpiperazin-1-yl)propylcarbamodithioic acid (PubChem CID 88699307) has the molecular formula C14H21N3S2 and a molecular weight of 295.48 g/mol. Its IUPAC name is 3-(4-phenylpiperazin-1-yl)propylcarbamodithioic acid.
| Compound Name | 3-(4-phenylpiperazin-1-yl)propylcarbamodithioic acid |
|---|---|
| PubChem CID | 88699307 |
| Molecular Formula | C14H21N3S2 |
| Molecular Weight | 295.48 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-(4-phenylpiperazin-1-yl)propylcarbamodithioic acid |
| SMILES | S=C(S)NCCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C14H21N3S2/c18-14(19)15-7-4-8-16-9-11-17(12-10-16)13-5-2-1-3-6-13/h1-3,5-6H,4,7-12H2,(H2,15,18,19) |
| InChIKey | IKMHUMIWZBEMCJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|