C23H30ClN3O — CID 55778311
4-(4-chlorophenyl)-N-[3-(4-phenylpiperazin-1-yl)propyl]butanamide (PubChem CID 55778311) has the molecular formula C23H30ClN3O and a molecular weight of 399.97 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[3-(4-phenylpiperazin-1-yl)propyl]butanamide.
| Compound Name | 4-(4-chlorophenyl)-N-[3-(4-phenylpiperazin-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 55778311 |
| Molecular Formula | C23H30ClN3O |
| Molecular Weight | 399.97 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[3-(4-phenylpiperazin-1-yl)propyl]butanamide |
| SMILES | O=C(CCCc1ccc(Cl)cc1)NCCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H30ClN3O/c24-21-12-10-20(11-13-21)6-4-9-23(28)25-14-5-15-26-16-18-27(19-17-26)22-7-2-1-3-8-22/h1-3,7-8,10-13H,4-6,9,14-19H2,(H,25,28) |
| InChIKey | RTZCINXUWCZELL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.97 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|