C14H29N3O — CID 103928449
(2R)-2-amino-3,3-dimethyl-N-(3-piperidin-1-ylpropyl)butanamide (PubChem CID 103928449) has the molecular formula C14H29N3O and a molecular weight of 255.41 g/mol. Its IUPAC name is (2R)-2-amino-3,3-dimethyl-N-(3-piperidin-1-ylpropyl)butanamide.
| Compound Name | (2R)-2-amino-3,3-dimethyl-N-(3-piperidin-1-ylpropyl)butanamide |
|---|---|
| PubChem CID | 103928449 |
| Molecular Formula | C14H29N3O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | (2R)-2-amino-3,3-dimethyl-N-(3-piperidin-1-ylpropyl)butanamide |
| SMILES | CC(C)(C)[C@@H](N)C(=O)NCCCN1CCCCC1 |
| InChI | InChI=1S/C14H29N3O/c1-14(2,3)12(15)13(18)16-8-7-11-17-9-5-4-6-10-17/h12H,4-11,15H2,1-3H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | BDHOJNXIHVIBMN-LBPRGKRZSA-N |
| XLogP | 1.35 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|