C20H34N4O — CID 119902156
(2S)-2-amino-3,3-dimethyl-N-[4-(4-phenylpiperazin-1-yl)butyl]butanamide (PubChem CID 119902156) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-[4-(4-phenylpiperazin-1-yl)butyl]butanamide.
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-[4-(4-phenylpiperazin-1-yl)butyl]butanamide |
|---|---|
| PubChem CID | 119902156 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-[4-(4-phenylpiperazin-1-yl)butyl]butanamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)NCCCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H34N4O/c1-20(2,3)18(21)19(25)22-11-7-8-12-23-13-15-24(16-14-23)17-9-5-4-6-10-17/h4-6,9-10,18H,7-8,11-16,21H2,1-3H3,(H,22,25)/t18-/m1/s1 |
| InChIKey | ZOUXIZHFHOYTEE-GOSISDBHSA-N |
| XLogP | 2.08 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|