C18H29N3O — CID 30899995
3,3-dimethyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]butanamide (PubChem CID 30899995) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is 3,3-dimethyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 30899995 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 3,3-dimethyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]butanamide |
| SMILES | CC(C)(C)CC(=O)NCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H29N3O/c1-18(2,3)15-17(22)19-9-10-20-11-13-21(14-12-20)16-7-5-4-6-8-16/h4-8H,9-15H2,1-3H3,(H,19,22) |
| InChIKey | NUVHIITZGSPCGH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |