C20H34N4O — CID 71910704
2-(dimethylamino)-N-[3-(4-phenylpiperazin-1-yl)propyl]pentanamide (PubChem CID 71910704) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-(4-phenylpiperazin-1-yl)propyl]pentanamide.
| Compound Name | 2-(dimethylamino)-N-[3-(4-phenylpiperazin-1-yl)propyl]pentanamide |
|---|---|
| PubChem CID | 71910704 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 2-(dimethylamino)-N-[3-(4-phenylpiperazin-1-yl)propyl]pentanamide |
| SMILES | CCCC(C(=O)NCCCN1CCN(c2ccccc2)CC1)N(C)C |
| InChI | InChI=1S/C20H34N4O/c1-4-9-19(22(2)3)20(25)21-12-8-13-23-14-16-24(17-15-23)18-10-6-5-7-11-18/h5-7,10-11,19H,4,8-9,12-17H2,1-3H3,(H,21,25) |
| InChIKey | YMEKVEBMVNWZBK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|