C15H31N3O — CID 61148247
(2S)-2-amino-3,3-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]butanamide (PubChem CID 61148247) has the molecular formula C15H31N3O and a molecular weight of 269.43 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]butanamide.
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 61148247 |
| Molecular Formula | C15H31N3O |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.25 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]butanamide |
| SMILES | CC1CCCCN1CCCNC(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C15H31N3O/c1-12-8-5-6-10-18(12)11-7-9-17-14(19)13(16)15(2,3)4/h12-13H,5-11,16H2,1-4H3,(H,17,19)/t12?,13-/m1/s1 |
| InChIKey | WYJIINXTTPFYSW-ZGTCLIOFSA-N |
| XLogP | 1.74 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|