C15H28N2O3 — CID 65297461
2,2-dimethyl-4-[3-(2-methylpiperidin-1-yl)propylamino]-4-oxobutanoic acid (PubChem CID 65297461) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2,2-dimethyl-4-[3-(2-methylpiperidin-1-yl)propylamino]-4-oxobutanoic acid.
| Compound Name | 2,2-dimethyl-4-[3-(2-methylpiperidin-1-yl)propylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 65297461 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 2,2-dimethyl-4-[3-(2-methylpiperidin-1-yl)propylamino]-4-oxobutanoic acid |
| SMILES | CC1CCCCN1CCCNC(=O)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C15H28N2O3/c1-12-7-4-5-9-17(12)10-6-8-16-13(18)11-15(2,3)14(19)20/h12H,4-11H2,1-3H3,(H,16,18)(H,19,20) |
| InChIKey | ADSFAHMHLIZUDB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|