C25H32N4O4S — CID 20936585
5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxy-N-[3-(4-phenylpiperazin-1-yl)propyl]benzenesulfonamide (PubChem CID 20936585) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is 5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxy-N-[3-(4-phenylpiperazin-1-yl)propyl]benzenesulfonamide.
| Compound Name | 5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxy-N-[3-(4-phenylpiperazin-1-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 20936585 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxy-N-[3-(4-phenylpiperazin-1-yl)propyl]benzenesulfonamide |
| SMILES | COc1ccc(-c2onc(C)c2C)cc1S(=O)(=O)NCCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H32N4O4S/c1-19-20(2)27-33-25(19)21-10-11-23(32-3)24(18-21)34(30,31)26-12-7-13-28-14-16-29(17-15-28)22-8-5-4-6-9-22/h4-6,8-11,18,26H,7,12-17H2,1-3H3 |
| InChIKey | HEZHQGAVFJVMDI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|