C9H7NOS — CID 163499090
2-phenyl-4H-1,3-oxazole-5-thione (PubChem CID 163499090) has the molecular formula C9H7NOS and a molecular weight of 177.23 g/mol. Its IUPAC name is 2-phenyl-4H-1,3-oxazole-5-thione.
| Compound Name | 2-phenyl-4H-1,3-oxazole-5-thione |
|---|---|
| PubChem CID | 163499090 |
| Molecular Formula | C9H7NOS |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | 2-phenyl-4H-1,3-oxazole-5-thione |
| SMILES | S=C1CN=C(c2ccccc2)O1 |
| InChI | InChI=1S/C9H7NOS/c12-8-6-10-9(11-8)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | VIQSYZZIXAUQKR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|