C16H12INO — CID 54769671
(5E)-5-[iodo(phenyl)methylidene]-2-phenyl-4H-1,3-oxazole (PubChem CID 54769671) has the molecular formula C16H12INO and a molecular weight of 361.18 g/mol. Its IUPAC name is (5E)-5-[iodo(phenyl)methylidene]-2-phenyl-4H-1,3-oxazole.
| Compound Name | (5E)-5-[iodo(phenyl)methylidene]-2-phenyl-4H-1,3-oxazole |
|---|---|
| PubChem CID | 54769671 |
| Molecular Formula | C16H12INO |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | (5E)-5-[iodo(phenyl)methylidene]-2-phenyl-4H-1,3-oxazole |
| SMILES | I/C(=C1\CN=C(c2ccccc2)O1)c1ccccc1 |
| InChI | InChI=1S/C16H12INO/c17-15(12-7-3-1-4-8-12)14-11-18-16(19-14)13-9-5-2-6-10-13/h1-10H,11H2/b15-14+ |
| InChIKey | SEALXPAEEXEDRJ-CCEZHUSRSA-N |
| XLogP | 4.27 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|