C14H10ClNO — CID 19099047
2-(4-chlorophenyl)-4H-1,3-benzoxazine (PubChem CID 19099047) has the molecular formula C14H10ClNO and a molecular weight of 243.69 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4H-1,3-benzoxazine.
| Compound Name | 2-(4-chlorophenyl)-4H-1,3-benzoxazine |
|---|---|
| PubChem CID | 19099047 |
| Molecular Formula | C14H10ClNO |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-(4-chlorophenyl)-4H-1,3-benzoxazine |
| SMILES | Clc1ccc(C2=NCc3ccccc3O2)cc1 |
| InChI | InChI=1S/C14H10ClNO/c15-12-7-5-10(6-8-12)14-16-9-11-3-1-2-4-13(11)17-14/h1-8H,9H2 |
| InChIKey | JMMGWUPXZQTNRN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |