C16H10ClNO2 — CID 102431034
(3Z)-5-(4-chlorophenyl)-1,6-benzoxazocin-2-one (PubChem CID 102431034) has the molecular formula C16H10ClNO2 and a molecular weight of 283.71 g/mol. Its IUPAC name is (3Z)-5-(4-chlorophenyl)-1,6-benzoxazocin-2-one.
| Compound Name | (3Z)-5-(4-chlorophenyl)-1,6-benzoxazocin-2-one |
|---|---|
| PubChem CID | 102431034 |
| Molecular Formula | C16H10ClNO2 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | (3Z)-5-(4-chlorophenyl)-1,6-benzoxazocin-2-one |
| SMILES | O=C1/C=C\C(c2ccc(Cl)cc2)=N/c2ccccc2O1 |
| InChI | InChI=1S/C16H10ClNO2/c17-12-7-5-11(6-8-12)13-9-10-16(19)20-15-4-2-1-3-14(15)18-13/h1-10H/b10-9-,18-13+ |
| InChIKey | YRGGMGZVHADXFR-FMPTWKBHSA-N |
| XLogP | 3.94 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|