C18H14ClNO2S — CID 141176199
ethyl 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate (PubChem CID 141176199) has the molecular formula C18H14ClNO2S and a molecular weight of 343.84 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate |
|---|---|
| PubChem CID | 141176199 |
| Molecular Formula | C18H14ClNO2S |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-1,5-benzothiazepine-2-carboxylate |
| SMILES | CCOC(=O)C1=CC(c2ccc(Cl)cc2)=Nc2ccccc2S1 |
| InChI | InChI=1S/C18H14ClNO2S/c1-2-22-18(21)17-11-15(12-7-9-13(19)10-8-12)20-14-5-3-4-6-16(14)23-17/h3-11H,2H2,1H3 |
| InChIKey | GZMMBNCRQOJUGA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |