C12H11Cl2NO2S — CID 20535196
chlorobenzene;ethyl 2-chloro-1,3-thiazole-5-carboxylate (PubChem CID 20535196) has the molecular formula C12H11Cl2NO2S and a molecular weight of 304.20 g/mol. Its IUPAC name is chlorobenzene;ethyl 2-chloro-1,3-thiazole-5-carboxylate.
| Compound Name | chlorobenzene;ethyl 2-chloro-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 20535196 |
| Molecular Formula | C12H11Cl2NO2S |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | chlorobenzene;ethyl 2-chloro-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)s1.Clc1ccccc1 |
| InChI | InChI=1S/C6H6ClNO2S.C6H5Cl/c1-2-10-5(9)4-3-8-6(7)11-4;7-6-4-2-1-3-5-6/h3H,2H2,1H3;1-5H |
| InChIKey | ULQASQAVHBQBOY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |