C16H15N5O2S — CID 141349333
ethyl 2-[(6-anilinopyrimidin-4-yl)amino]-1,3-thiazole-5-carboxylate (PubChem CID 141349333) has the molecular formula C16H15N5O2S and a molecular weight of 341.40 g/mol. Its IUPAC name is ethyl 2-[(6-anilinopyrimidin-4-yl)amino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(6-anilinopyrimidin-4-yl)amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 141349333 |
| Molecular Formula | C16H15N5O2S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | ethyl 2-[(6-anilinopyrimidin-4-yl)amino]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2cc(Nc3ccccc3)ncn2)s1 |
| InChI | InChI=1S/C16H15N5O2S/c1-2-23-15(22)12-9-17-16(24-12)21-14-8-13(18-10-19-14)20-11-6-4-3-5-7-11/h3-10H,2H2,1H3,(H2,17,18,19,20,21) |
| InChIKey | WYKWOGBIURDDDL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |