C15H13N5O2S — CID 141349337
2-[[6-(benzylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid (PubChem CID 141349337) has the molecular formula C15H13N5O2S and a molecular weight of 327.37 g/mol. Its IUPAC name is 2-[[6-(benzylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[[6-(benzylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 141349337 |
| Molecular Formula | C15H13N5O2S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-[[6-(benzylamino)pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(Nc2cc(NCc3ccccc3)ncn2)s1 |
| InChI | InChI=1S/C15H13N5O2S/c21-14(22)11-8-17-15(23-11)20-13-6-12(18-9-19-13)16-7-10-4-2-1-3-5-10/h1-6,8-9H,7H2,(H,21,22)(H2,16,17,18,19,20) |
| InChIKey | HKYRYAFZFVCXNC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |