C10H6Cl2N2O2S — CID 80571332
2-(2,6-dichloroanilino)-1,3-thiazole-5-carboxylic acid (PubChem CID 80571332) has the molecular formula C10H6Cl2N2O2S and a molecular weight of 289.14 g/mol. Its IUPAC name is 2-(2,6-dichloroanilino)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(2,6-dichloroanilino)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 80571332 |
| Molecular Formula | C10H6Cl2N2O2S |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 287.95 |
| IUPAC Name | 2-(2,6-dichloroanilino)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(Nc2c(Cl)cccc2Cl)s1 |
| InChI | InChI=1S/C10H6Cl2N2O2S/c11-5-2-1-3-6(12)8(5)14-10-13-4-7(17-10)9(15)16/h1-4H,(H,13,14)(H,15,16) |
| InChIKey | AXLMQDZMPKRRGP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |