C10H4Cl2N4O2S2 — CID 80571642
2-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-1,3-thiazole-5-carboxylic acid (PubChem CID 80571642) has the molecular formula C10H4Cl2N4O2S2 and a molecular weight of 347.21 g/mol. Its IUPAC name is 2-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 80571642 |
| Molecular Formula | C10H4Cl2N4O2S2 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 345.92 |
| IUPAC Name | 2-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(Nc2c(Cl)cc(Cl)c3c2N=S=N3)s1 |
| InChI | InChI=1S/C10H4Cl2N4O2S2/c11-3-1-4(12)7-8(16-20-15-7)6(3)14-10-13-2-5(19-10)9(17)18/h1-2H,(H,13,14)(H,17,18) |
| InChIKey | VWTRAVDFXDXLSX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |