C10H5Cl2FN2O2S — CID 107580551
2-(3,5-dichloro-4-fluoroanilino)-1,3-thiazole-5-carboxylic acid (PubChem CID 107580551) has the molecular formula C10H5Cl2FN2O2S and a molecular weight of 307.13 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-fluoroanilino)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(3,5-dichloro-4-fluoroanilino)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 107580551 |
| Molecular Formula | C10H5Cl2FN2O2S |
| Molecular Weight | 307.13 g/mol |
| Exact Mass | 305.94 |
| IUPAC Name | 2-(3,5-dichloro-4-fluoroanilino)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(Nc2cc(Cl)c(F)c(Cl)c2)s1 |
| InChI | InChI=1S/C10H5Cl2FN2O2S/c11-5-1-4(2-6(12)8(5)13)15-10-14-3-7(18-10)9(16)17/h1-3H,(H,14,15)(H,16,17) |
| InChIKey | IESPCIRXJZISJD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.13 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|