C7H8N2O4S2 — CID 165485403
2-(cyclopropylsulfonylamino)-1,3-thiazole-5-carboxylic acid (PubChem CID 165485403) has the molecular formula C7H8N2O4S2 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-(cyclopropylsulfonylamino)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(cyclopropylsulfonylamino)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 165485403 |
| Molecular Formula | C7H8N2O4S2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 2-(cyclopropylsulfonylamino)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(NS(=O)(=O)C2CC2)s1 |
| InChI | InChI=1S/C7H8N2O4S2/c10-6(11)5-3-8-7(14-5)9-15(12,13)4-1-2-4/h3-4H,1-2H2,(H,8,9)(H,10,11) |
| InChIKey | NUCIKIMXOXMZGP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |