C10H14N2O2S2 — CID 80612543
2-(thian-2-ylmethylamino)-1,3-thiazole-5-carboxylic acid (PubChem CID 80612543) has the molecular formula C10H14N2O2S2 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-(thian-2-ylmethylamino)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(thian-2-ylmethylamino)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 80612543 |
| Molecular Formula | C10H14N2O2S2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-(thian-2-ylmethylamino)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCC2CCCCS2)s1 |
| InChI | InChI=1S/C10H14N2O2S2/c13-9(14)8-6-12-10(16-8)11-5-7-3-1-2-4-15-7/h6-7H,1-5H2,(H,11,12)(H,13,14) |
| InChIKey | YZKMSRZOQPZDIQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |