C9H11NO2S2 — CID 115090879
2-(thiolan-2-ylmethyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 115090879) has the molecular formula C9H11NO2S2 and a molecular weight of 229.33 g/mol. Its IUPAC name is 2-(thiolan-2-ylmethyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(thiolan-2-ylmethyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 115090879 |
| Molecular Formula | C9H11NO2S2 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 2-(thiolan-2-ylmethyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(CC2CCCS2)s1 |
| InChI | InChI=1S/C9H11NO2S2/c11-9(12)7-5-10-8(14-7)4-6-2-1-3-13-6/h5-6H,1-4H2,(H,11,12) |
| InChIKey | PVNYJFCLLFJFTN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |