C14H16N2O2S — CID 117140239
3-(thian-2-ylmethyl)imidazo[1,5-a]pyridine-6-carboxylic acid (PubChem CID 117140239) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 3-(thian-2-ylmethyl)imidazo[1,5-a]pyridine-6-carboxylic acid.
| Compound Name | 3-(thian-2-ylmethyl)imidazo[1,5-a]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 117140239 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 3-(thian-2-ylmethyl)imidazo[1,5-a]pyridine-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2cnc(CC3CCCCS3)n2c1 |
| InChI | InChI=1S/C14H16N2O2S/c17-14(18)10-4-5-11-8-15-13(16(11)9-10)7-12-3-1-2-6-19-12/h4-5,8-9,12H,1-3,6-7H2,(H,17,18) |
| InChIKey | KKGUDCGLUNPNBN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |