C15H18N2O2S — CID 117142671
methyl 3-(thian-2-ylmethyl)imidazo[1,5-a]pyridine-5-carboxylate (PubChem CID 117142671) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is methyl 3-(thian-2-ylmethyl)imidazo[1,5-a]pyridine-5-carboxylate.
| Compound Name | methyl 3-(thian-2-ylmethyl)imidazo[1,5-a]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 117142671 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | methyl 3-(thian-2-ylmethyl)imidazo[1,5-a]pyridine-5-carboxylate |
| SMILES | COC(=O)c1cccc2cnc(CC3CCCCS3)n12 |
| InChI | InChI=1S/C15H18N2O2S/c1-19-15(18)13-7-4-5-11-10-16-14(17(11)13)9-12-6-2-3-8-20-12/h4-5,7,10,12H,2-3,6,8-9H2,1H3 |
| InChIKey | KYBAISUZNNNMTJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |