C13H15BrN2S — CID 117144243
7-bromo-3-(thian-2-ylmethyl)imidazo[1,5-a]pyridine (PubChem CID 117144243) has the molecular formula C13H15BrN2S and a molecular weight of 311.25 g/mol. Its IUPAC name is 7-bromo-3-(thian-2-ylmethyl)imidazo[1,5-a]pyridine.
| Compound Name | 7-bromo-3-(thian-2-ylmethyl)imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117144243 |
| Molecular Formula | C13H15BrN2S |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 7-bromo-3-(thian-2-ylmethyl)imidazo[1,5-a]pyridine |
| SMILES | Brc1ccn2c(CC3CCCCS3)ncc2c1 |
| InChI | InChI=1S/C13H15BrN2S/c14-10-4-5-16-11(7-10)9-15-13(16)8-12-3-1-2-6-17-12/h4-5,7,9,12H,1-3,6,8H2 |
| InChIKey | OPYXDWOQTDIDQF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |