C10H9N3O2S — CID 87396018
2-(2-aminoanilino)-1,3-thiazole-5-carboxylic acid (PubChem CID 87396018) has the molecular formula C10H9N3O2S and a molecular weight of 235.27 g/mol. Its IUPAC name is 2-(2-aminoanilino)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(2-aminoanilino)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 87396018 |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 2-(2-aminoanilino)-1,3-thiazole-5-carboxylic acid |
| SMILES | Nc1ccccc1Nc1ncc(C(=O)O)s1 |
| InChI | InChI=1S/C10H9N3O2S/c11-6-3-1-2-4-7(6)13-10-12-5-8(16-10)9(14)15/h1-5H,11H2,(H,12,13)(H,14,15) |
| InChIKey | GWEDYNPDKGCNPX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|