C8H9ClN2O3S — CID 83306355
ethyl 2-[(2-chloroacetyl)amino]-1,3-thiazole-5-carboxylate (PubChem CID 83306355) has the molecular formula C8H9ClN2O3S and a molecular weight of 248.69 g/mol. Its IUPAC name is ethyl 2-[(2-chloroacetyl)amino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(2-chloroacetyl)amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 83306355 |
| Molecular Formula | C8H9ClN2O3S |
| Molecular Weight | 248.69 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | ethyl 2-[(2-chloroacetyl)amino]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC(=O)CCl)s1 |
| InChI | InChI=1S/C8H9ClN2O3S/c1-2-14-7(13)5-4-10-8(15-5)11-6(12)3-9/h4H,2-3H2,1H3,(H,10,11,12) |
| InChIKey | BZJCEASAGNFBSP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.69 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|