C12H12ClN3O2S — CID 154842535
ethyl 2-[(2-chloro-4-pyridinyl)methylamino]-1,3-thiazole-5-carboxylate (PubChem CID 154842535) has the molecular formula C12H12ClN3O2S and a molecular weight of 297.77 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-4-pyridinyl)methylamino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(2-chloro-4-pyridinyl)methylamino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 154842535 |
| Molecular Formula | C12H12ClN3O2S |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | ethyl 2-[(2-chloro-4-pyridinyl)methylamino]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCc2ccnc(Cl)c2)s1 |
| InChI | InChI=1S/C12H12ClN3O2S/c1-2-18-11(17)9-7-16-12(19-9)15-6-8-3-4-14-10(13)5-8/h3-5,7H,2,6H2,1H3,(H,15,16) |
| InChIKey | UFDGXJNCVAYJKI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|