C12H10ClNO3S — CID 59823678
ethyl 2-(3-chlorophenoxy)-1,3-thiazole-5-carboxylate (PubChem CID 59823678) has the molecular formula C12H10ClNO3S and a molecular weight of 283.74 g/mol. Its IUPAC name is ethyl 2-(3-chlorophenoxy)-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-(3-chlorophenoxy)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 59823678 |
| Molecular Formula | C12H10ClNO3S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | ethyl 2-(3-chlorophenoxy)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Oc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C12H10ClNO3S/c1-2-16-11(15)10-7-14-12(18-10)17-9-5-3-4-8(13)6-9/h3-7H,2H2,1H3 |
| InChIKey | IRSOKFRIKYVEEO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |