C18H14ClN3O3 — CID 71228253
ethyl 5-(3-chlorophenoxy)-3-phenyl-1,2,4-triazine-6-carboxylate (PubChem CID 71228253) has the molecular formula C18H14ClN3O3 and a molecular weight of 355.78 g/mol. Its IUPAC name is ethyl 5-(3-chlorophenoxy)-3-phenyl-1,2,4-triazine-6-carboxylate.
| Compound Name | ethyl 5-(3-chlorophenoxy)-3-phenyl-1,2,4-triazine-6-carboxylate |
|---|---|
| PubChem CID | 71228253 |
| Molecular Formula | C18H14ClN3O3 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | ethyl 5-(3-chlorophenoxy)-3-phenyl-1,2,4-triazine-6-carboxylate |
| SMILES | CCOC(=O)c1nnc(-c2ccccc2)nc1Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H14ClN3O3/c1-2-24-18(23)15-17(25-14-10-6-9-13(19)11-14)20-16(22-21-15)12-7-4-3-5-8-12/h3-11H,2H2,1H3 |
| InChIKey | OIVNMGXKJLCKMN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |