C16H13N3O3S — CID 6411671
ethyl 5-phenoxy-3-thiophen-2-yl-1,2,4-triazine-6-carboxylate (PubChem CID 6411671) has the molecular formula C16H13N3O3S and a molecular weight of 327.37 g/mol. Its IUPAC name is ethyl 5-phenoxy-3-thiophen-2-yl-1,2,4-triazine-6-carboxylate.
| Compound Name | ethyl 5-phenoxy-3-thiophen-2-yl-1,2,4-triazine-6-carboxylate |
|---|---|
| PubChem CID | 6411671 |
| Molecular Formula | C16H13N3O3S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | ethyl 5-phenoxy-3-thiophen-2-yl-1,2,4-triazine-6-carboxylate |
| SMILES | CCOC(=O)c1nnc(-c2cccs2)nc1Oc1ccccc1 |
| InChI | InChI=1S/C16H13N3O3S/c1-2-21-16(20)13-15(22-11-7-4-3-5-8-11)17-14(19-18-13)12-9-6-10-23-12/h3-10H,2H2,1H3 |
| InChIKey | DUBVUVJAXZEKPV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |