C13H10Cl2N2O3 — CID 19934748
ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate (PubChem CID 19934748) has the molecular formula C13H10Cl2N2O3 and a molecular weight of 313.14 g/mol. Its IUPAC name is ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate.
| Compound Name | ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 19934748 |
| Molecular Formula | C13H10Cl2N2O3 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate |
| SMILES | CCOC(=O)c1nc(Cl)nc(Cl)c1Oc1ccccc1 |
| InChI | InChI=1S/C13H10Cl2N2O3/c1-2-19-12(18)9-10(11(14)17-13(15)16-9)20-8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChIKey | NYFAWTADJNVKGH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |