ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate

C13H10Cl2N2O3 — CID 19934748

IUPACethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate
SMILESCCOC(=O)c1nc(Cl)nc(Cl)c1Oc1ccccc1
InChIInChI=1S/C13H10Cl2N2O3/c1-2-19-12(18)9-10(11(14)17-13(15)16-9)20-8-6-4-3-5-7-8/h3-7H,2H2,1H3
InChIKeyNYFAWTADJNVKGH-UHFFFAOYSA-N
MW313.14 g/mol
LogP3.75
Rot. Bonds4

About ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate

ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate (PubChem CID 19934748) has the molecular formula C13H10Cl2N2O3 and a molecular weight of 313.14 g/mol. Its IUPAC name is ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate.

Molecular Properties

Compound Nameethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate
PubChem CID19934748
Molecular FormulaC13H10Cl2N2O3
Molecular Weight313.14 g/mol
Exact Mass312.01
IUPAC Nameethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate
SMILESCCOC(=O)c1nc(Cl)nc(Cl)c1Oc1ccccc1
InChIInChI=1S/C13H10Cl2N2O3/c1-2-19-12(18)9-10(11(14)17-13(15)16-9)20-8-6-4-3-5-7-8/h3-7H,2H2,1H3
InChIKeyNYFAWTADJNVKGH-UHFFFAOYSA-N
XLogP3.75
TPSA61.31 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.14
LogP ≤ 53.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate?
The IUPAC name of ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate (CID 19934748) is ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate.
What is the SMILES notation for ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate?
The canonical SMILES for ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate is CCOC(=O)c1nc(Cl)nc(Cl)c1Oc1ccccc1.
What is the InChIKey of ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate?
The InChIKey is NYFAWTADJNVKGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2N2O3/c1-2-19-12(18)9-10(11(14)17-13(15)16-9)20-8-6-4-3-5-7-8/h3-7H,2H2,1H3.
What are the key properties of ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate?
ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate has a molecular weight of 313.14 g/mol, XLogP of 3.75, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,6-dichloro-5-phenoxypyrimidine-4-carboxylate is sourced from PubChem (CID 19934748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).