C20H18ClNO4 — CID 86595469
butyl 1-chloro-4-hydroxy-6-phenoxyisoquinoline-3-carboxylate (PubChem CID 86595469) has the molecular formula C20H18ClNO4 and a molecular weight of 371.82 g/mol. Its IUPAC name is butyl 1-chloro-4-hydroxy-6-phenoxyisoquinoline-3-carboxylate.
| Compound Name | butyl 1-chloro-4-hydroxy-6-phenoxyisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 86595469 |
| Molecular Formula | C20H18ClNO4 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | butyl 1-chloro-4-hydroxy-6-phenoxyisoquinoline-3-carboxylate |
| SMILES | CCCCOC(=O)c1nc(Cl)c2ccc(Oc3ccccc3)cc2c1O |
| InChI | InChI=1S/C20H18ClNO4/c1-2-3-11-25-20(24)17-18(23)16-12-14(9-10-15(16)19(21)22-17)26-13-7-5-4-6-8-13/h4-10,12,23H,2-3,11H2,1H3 |
| InChIKey | RPRAPAIOFQXEFQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|