C23H22ClNO4 — CID 156786187
butyl 6-(3-chlorophenoxy)-1-cyclopropyl-4-hydroxyisoquinoline-3-carboxylate (PubChem CID 156786187) has the molecular formula C23H22ClNO4 and a molecular weight of 411.89 g/mol. Its IUPAC name is butyl 6-(3-chlorophenoxy)-1-cyclopropyl-4-hydroxyisoquinoline-3-carboxylate.
| Compound Name | butyl 6-(3-chlorophenoxy)-1-cyclopropyl-4-hydroxyisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 156786187 |
| Molecular Formula | C23H22ClNO4 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | butyl 6-(3-chlorophenoxy)-1-cyclopropyl-4-hydroxyisoquinoline-3-carboxylate |
| SMILES | CCCCOC(=O)c1nc(C2CC2)c2ccc(Oc3cccc(Cl)c3)cc2c1O |
| InChI | InChI=1S/C23H22ClNO4/c1-2-3-11-28-23(27)21-22(26)19-13-17(29-16-6-4-5-15(24)12-16)9-10-18(19)20(25-21)14-7-8-14/h4-6,9-10,12-14,26H,2-3,7-8,11H2,1H3 |
| InChIKey | RFYYDVOBXAHDJW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|