C20H18FNO4 — CID 66712966
butyl 7-(4-fluorophenoxy)-4-hydroxyisoquinoline-3-carboxylate (PubChem CID 66712966) has the molecular formula C20H18FNO4 and a molecular weight of 355.37 g/mol. Its IUPAC name is butyl 7-(4-fluorophenoxy)-4-hydroxyisoquinoline-3-carboxylate.
| Compound Name | butyl 7-(4-fluorophenoxy)-4-hydroxyisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 66712966 |
| Molecular Formula | C20H18FNO4 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | butyl 7-(4-fluorophenoxy)-4-hydroxyisoquinoline-3-carboxylate |
| SMILES | CCCCOC(=O)c1ncc2cc(Oc3ccc(F)cc3)ccc2c1O |
| InChI | InChI=1S/C20H18FNO4/c1-2-3-10-25-20(24)18-19(23)17-9-8-16(11-13(17)12-22-18)26-15-6-4-14(21)5-7-15/h4-9,11-12,23H,2-3,10H2,1H3 |
| InChIKey | HBQIMIUTMVTQRW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|