C21H20FNO5 — CID 66712881
butyl 6-(3-fluoro-5-methoxyphenoxy)-4-hydroxyisoquinoline-3-carboxylate (PubChem CID 66712881) has the molecular formula C21H20FNO5 and a molecular weight of 385.39 g/mol. Its IUPAC name is butyl 6-(3-fluoro-5-methoxyphenoxy)-4-hydroxyisoquinoline-3-carboxylate.
| Compound Name | butyl 6-(3-fluoro-5-methoxyphenoxy)-4-hydroxyisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 66712881 |
| Molecular Formula | C21H20FNO5 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | butyl 6-(3-fluoro-5-methoxyphenoxy)-4-hydroxyisoquinoline-3-carboxylate |
| SMILES | CCCCOC(=O)c1ncc2ccc(Oc3cc(F)cc(OC)c3)cc2c1O |
| InChI | InChI=1S/C21H20FNO5/c1-3-4-7-27-21(25)19-20(24)18-11-15(6-5-13(18)12-23-19)28-17-9-14(22)8-16(10-17)26-2/h5-6,8-12,24H,3-4,7H2,1-2H3 |
| InChIKey | ZYJFHEAICFTVNV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|