C24H21NO4S — CID 67233909
butyl 7-hydroxy-2-(4-phenoxyphenyl)thieno[3,2-c]pyridine-6-carboxylate (PubChem CID 67233909) has the molecular formula C24H21NO4S and a molecular weight of 419.50 g/mol. Its IUPAC name is butyl 7-hydroxy-2-(4-phenoxyphenyl)thieno[3,2-c]pyridine-6-carboxylate.
| Compound Name | butyl 7-hydroxy-2-(4-phenoxyphenyl)thieno[3,2-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 67233909 |
| Molecular Formula | C24H21NO4S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | butyl 7-hydroxy-2-(4-phenoxyphenyl)thieno[3,2-c]pyridine-6-carboxylate |
| SMILES | CCCCOC(=O)c1ncc2cc(-c3ccc(Oc4ccccc4)cc3)sc2c1O |
| InChI | InChI=1S/C24H21NO4S/c1-2-3-13-28-24(27)21-22(26)23-17(15-25-21)14-20(30-23)16-9-11-19(12-10-16)29-18-7-5-4-6-8-18/h4-12,14-15,26H,2-3,13H2,1H3 |
| InChIKey | AHSGLZRAWXJRNN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|