C20H17ClFNO4 — CID 66712902
butyl 6-(3-chloro-4-fluorophenoxy)-4-hydroxyisoquinoline-3-carboxylate (PubChem CID 66712902) has the molecular formula C20H17ClFNO4 and a molecular weight of 389.81 g/mol. Its IUPAC name is butyl 6-(3-chloro-4-fluorophenoxy)-4-hydroxyisoquinoline-3-carboxylate.
| Compound Name | butyl 6-(3-chloro-4-fluorophenoxy)-4-hydroxyisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 66712902 |
| Molecular Formula | C20H17ClFNO4 |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | butyl 6-(3-chloro-4-fluorophenoxy)-4-hydroxyisoquinoline-3-carboxylate |
| SMILES | CCCCOC(=O)c1ncc2ccc(Oc3ccc(F)c(Cl)c3)cc2c1O |
| InChI | InChI=1S/C20H17ClFNO4/c1-2-3-8-26-20(25)18-19(24)15-9-13(5-4-12(15)11-23-18)27-14-6-7-17(22)16(21)10-14/h4-7,9-11,24H,2-3,8H2,1H3 |
| InChIKey | UGAREZLLQROYQH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|